C16H14Cl2N4O2S — CID 7725838
[(1S)-1-cyanoethyl] 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 7725838) has the molecular formula C16H14Cl2N4O2S and a molecular weight of 397.29 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | [(1S)-1-cyanoethyl] 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7725838 |
| Molecular Formula | C16H14Cl2N4O2S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [(1S)-1-cyanoethyl] 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | C=CCn1c(SCC(=O)O[C@@H](C)C#N)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N4O2S/c1-3-6-22-15(12-5-4-11(17)7-13(12)18)20-21-16(22)25-9-14(23)24-10(2)8-19/h3-5,7,10H,1,6,9H2,2H3/t10-/m0/s1 |
| InChIKey | HWRCTMNLBXLCBW-JTQLQIEISA-N |
| XLogP | 3.99 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|