C21H21ClN4O2S — CID 39855435
N-(2-chloro-5-methoxyphenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 39855435) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 39855435 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(OC)ccc2Cl)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21ClN4O2S/c1-4-11-26-20(15-7-5-14(2)6-8-15)24-25-21(26)29-13-19(27)23-18-12-16(28-3)9-10-17(18)22/h4-10,12H,1,11,13H2,2-3H3,(H,23,27) |
| InChIKey | MDZZTIHVFHLGNY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|