C20H18Cl2N4OS — CID 2045584
N-(2,6-dichlorophenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2045584) has the molecular formula C20H18Cl2N4OS and a molecular weight of 433.36 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2045584 |
| Molecular Formula | C20H18Cl2N4OS |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2c(Cl)cccc2Cl)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18Cl2N4OS/c1-3-11-26-19(14-9-7-13(2)8-10-14)24-25-20(26)28-12-17(27)23-18-15(21)5-4-6-16(18)22/h3-10H,1,11-12H2,2H3,(H,23,27) |
| InChIKey | WPQZVHUBEVWBPZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|