C17H14Cl2N4OS2 — CID 19725614
N-(2,6-dichlorophenyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 19725614) has the molecular formula C17H14Cl2N4OS2 and a molecular weight of 425.37 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19725614 |
| Molecular Formula | C17H14Cl2N4OS2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2c(Cl)cccc2Cl)nnc1-c1cccs1 |
| InChI | InChI=1S/C17H14Cl2N4OS2/c1-2-8-23-16(13-7-4-9-25-13)21-22-17(23)26-10-14(24)20-15-11(18)5-3-6-12(15)19/h2-7,9H,1,8,10H2,(H,20,24) |
| InChIKey | HUGAEIJHQPYPHD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|