C20H17ClF2N4O2S — CID 17262244
N-(2-chlorophenyl)-2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17262244) has the molecular formula C20H17ClF2N4O2S and a molecular weight of 450.90 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17262244 |
| Molecular Formula | C20H17ClF2N4O2S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2Cl)nnc1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H17ClF2N4O2S/c1-2-11-27-18(13-7-9-14(10-8-13)29-19(22)23)25-26-20(27)30-12-17(28)24-16-6-4-3-5-15(16)21/h2-10,19H,1,11-12H2,(H,24,28) |
| InChIKey | YIDYZNNVYSXYAM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|