C23H26N4O2S — CID 19732420
2-[[5-(4-ethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethylphenyl)acetamide (PubChem CID 19732420) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[[5-(4-ethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[[5-(4-ethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 19732420 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[[5-(4-ethoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2CC)nnc1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-4-15-27-22(18-11-13-19(14-12-18)29-6-3)25-26-23(27)30-16-21(28)24-20-10-8-7-9-17(20)5-2/h4,7-14H,1,5-6,15-16H2,2-3H3,(H,24,28) |
| InChIKey | RMMHTWNWMNFYAD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|