C24H25F3N4O2S — CID 19732779
2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 19732779) has the molecular formula C24H25F3N4O2S and a molecular weight of 490.55 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19732779 |
| Molecular Formula | C24H25F3N4O2S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C(F)(F)F)nnc1-c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C24H25F3N4O2S/c1-3-5-15-33-18-12-10-17(11-13-18)22-29-30-23(31(22)14-4-2)34-16-21(32)28-20-9-7-6-8-19(20)24(25,26)27/h4,6-13H,2-3,5,14-16H2,1H3,(H,28,32) |
| InChIKey | RPUVNIWHRWWRMZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|