C22H21ClN4O3S — CID 4554920
methyl 4-chloro-3-[[2-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 4554920) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4554920 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | methyl 4-chloro-3-[[2-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(C(=O)OC)ccc2Cl)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C22H21ClN4O3S/c1-4-10-27-20(15-7-5-6-14(2)11-15)25-26-22(27)31-13-19(28)24-18-12-16(21(29)30-3)8-9-17(18)23/h4-9,11-12H,1,10,13H2,2-3H3,(H,24,28) |
| InChIKey | PIAPSJIOVFPBBZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|