C16H16ClN5O2S — CID 19724438
N-(2-chloro-3-pyridinyl)-2-[[5-(furan-2-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19724438) has the molecular formula C16H16ClN5O2S and a molecular weight of 377.86 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(furan-2-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(furan-2-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19724438 |
| Molecular Formula | C16H16ClN5O2S |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(furan-2-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2cccnc2Cl)nnc1-c1ccco1 |
| InChI | InChI=1S/C16H16ClN5O2S/c1-2-8-22-15(12-6-4-9-24-12)20-21-16(22)25-10-13(23)19-11-5-3-7-18-14(11)17/h3-7,9H,2,8,10H2,1H3,(H,19,23) |
| InChIKey | LZTVOIWDIVWDIC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|