C14H9Cl2F3N2OS — CID 4847268
N-(2-chloro-3-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 4847268) has the molecular formula C14H9Cl2F3N2OS and a molecular weight of 381.21 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 4847268 |
| Molecular Formula | C14H9Cl2F3N2OS |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)c(C(F)(F)F)c1)Nc1cccnc1Cl |
| InChI | InChI=1S/C14H9Cl2F3N2OS/c15-10-4-3-8(6-9(10)14(17,18)19)23-7-12(22)21-11-2-1-5-20-13(11)16/h1-6H,7H2,(H,21,22) |
| InChIKey | KCLBEYATYWBBCR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|