C15H10ClF6N3O — CID 7592959
2-[3,5-bis(trifluoromethyl)anilino]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 7592959) has the molecular formula C15H10ClF6N3O and a molecular weight of 397.71 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)anilino]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)anilino]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 7592959 |
| Molecular Formula | C15H10ClF6N3O |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)anilino]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | O=C(CNc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H10ClF6N3O/c16-13-11(2-1-3-23-13)25-12(26)7-24-10-5-8(14(17,18)19)4-9(6-10)15(20,21)22/h1-6,24H,7H2,(H,25,26) |
| InChIKey | QQBHFAHQQZYPNW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|