C21H28ClN3O — CID 9129529
2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 9129529) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 9129529 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | CC(C)[C@H](NCC(=O)Nc1cccnc1Cl)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28ClN3O/c1-14(2)19(15-8-10-16(11-9-15)21(3,4)5)24-13-18(26)25-17-7-6-12-23-20(17)22/h6-12,14,19,24H,13H2,1-5H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | YRBUHZGAHHLJJO-IBGZPJMESA-N |
| XLogP | 4.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|