C18H20ClIN2O — CID 41378344
2-[[(1S)-1-(4-chlorophenyl)-2-methylpropyl]amino]-N-(2-iodophenyl)acetamide (PubChem CID 41378344) has the molecular formula C18H20ClIN2O and a molecular weight of 442.73 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-chlorophenyl)-2-methylpropyl]amino]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[[(1S)-1-(4-chlorophenyl)-2-methylpropyl]amino]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 41378344 |
| Molecular Formula | C18H20ClIN2O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 2-[[(1S)-1-(4-chlorophenyl)-2-methylpropyl]amino]-N-(2-iodophenyl)acetamide |
| SMILES | CC(C)[C@H](NCC(=O)Nc1ccccc1I)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClIN2O/c1-12(2)18(13-7-9-14(19)10-8-13)21-11-17(23)22-16-6-4-3-5-15(16)20/h3-10,12,18,21H,11H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | LCZFBBVXNCSOMJ-SFHVURJKSA-N |
| XLogP | 4.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|