C14H8Cl2F4N4O2 — CID 3523141
N,N'-bis(2-chloro-3-pyridinyl)-2,2,3,3-tetrafluorobutanediamide (PubChem CID 3523141) has the molecular formula C14H8Cl2F4N4O2 and a molecular weight of 411.14 g/mol. Its IUPAC name is N,N'-bis(2-chloro-3-pyridinyl)-2,2,3,3-tetrafluorobutanediamide.
| Compound Name | N,N'-bis(2-chloro-3-pyridinyl)-2,2,3,3-tetrafluorobutanediamide |
|---|---|
| PubChem CID | 3523141 |
| Molecular Formula | C14H8Cl2F4N4O2 |
| Molecular Weight | 411.14 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | N,N'-bis(2-chloro-3-pyridinyl)-2,2,3,3-tetrafluorobutanediamide |
| SMILES | O=C(Nc1cccnc1Cl)C(F)(F)C(F)(F)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C14H8Cl2F4N4O2/c15-9-7(3-1-5-21-9)23-11(25)13(17,18)14(19,20)12(26)24-8-4-2-6-22-10(8)16/h1-6H,(H,23,25)(H,24,26) |
| InChIKey | BBNJYHBGWVHWLM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.14 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|