C15H22ClN3O2 — CID 108520466
N-(2-chloro-3-pyridinyl)-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108520466) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108520466 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H22ClN3O2/c1-10(2)8-19(9-11(3)4)15(21)14(20)18-12-6-5-7-17-13(12)16/h5-7,10-11H,8-9H2,1-4H3,(H,18,20) |
| InChIKey | HWIZVRKAYLDMOU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|