C10H12ClN3O3 — CID 44999728
N'-(2-chloro-3-pyridinyl)-N-(3-hydroxypropyl)oxamide (PubChem CID 44999728) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is N'-(2-chloro-3-pyridinyl)-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-(2-chloro-3-pyridinyl)-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 44999728 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N'-(2-chloro-3-pyridinyl)-N-(3-hydroxypropyl)oxamide |
| SMILES | O=C(NCCCO)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C10H12ClN3O3/c11-8-7(3-1-4-12-8)14-10(17)9(16)13-5-2-6-15/h1,3-4,15H,2,5-6H2,(H,13,16)(H,14,17) |
| InChIKey | BPYBISKSDOXJPG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|