C11H12Cl2N2O3 — CID 2266325
N'-(2,3-dichlorophenyl)-N-(3-hydroxypropyl)oxamide (PubChem CID 2266325) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-(2,3-dichlorophenyl)-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 2266325 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | N'-(2,3-dichlorophenyl)-N-(3-hydroxypropyl)oxamide |
| SMILES | O=C(NCCCO)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c12-7-3-1-4-8(9(7)13)15-11(18)10(17)14-5-2-6-16/h1,3-4,16H,2,5-6H2,(H,14,17)(H,15,18) |
| InChIKey | NJLBZLZQDLJISC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|