C11H12Cl2N2O3 — CID 620497
N'-(2,3-dichlorophenyl)-N-(2-methoxyethyl)oxamide (PubChem CID 620497) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-(2,3-dichlorophenyl)-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 620497 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | N'-(2,3-dichlorophenyl)-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c1-18-6-5-14-10(16)11(17)15-8-4-2-3-7(12)9(8)13/h2-4H,5-6H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | FQSKKBNUGMWZES-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|