C12H13Cl2N3O3 — CID 86996127
N'-(2,3-dichlorophenyl)-N-[2-(ethylamino)-2-oxoethyl]oxamide (PubChem CID 86996127) has the molecular formula C12H13Cl2N3O3 and a molecular weight of 318.16 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)-N-[2-(ethylamino)-2-oxoethyl]oxamide.
| Compound Name | N'-(2,3-dichlorophenyl)-N-[2-(ethylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 86996127 |
| Molecular Formula | C12H13Cl2N3O3 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N'-(2,3-dichlorophenyl)-N-[2-(ethylamino)-2-oxoethyl]oxamide |
| SMILES | CCNC(=O)CNC(=O)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2N3O3/c1-2-15-9(18)6-16-11(19)12(20)17-8-5-3-4-7(13)10(8)14/h3-5H,2,6H2,1H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | SZKRHTUOGLSYPL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|