C16H14Cl2N2O2 — CID 108500732
N-(2,3-dichlorophenyl)-N'-ethyl-N'-phenyloxamide (PubChem CID 108500732) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-ethyl-N'-phenyloxamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-ethyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108500732 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-ethyl-N'-phenyloxamide |
| SMILES | CCN(C(=O)C(=O)Nc1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c1-2-20(11-7-4-3-5-8-11)16(22)15(21)19-13-10-6-9-12(17)14(13)18/h3-10H,2H2,1H3,(H,19,21) |
| InChIKey | FWMHNEFTWORERH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|