C16H16Cl2N2O — CID 3539470
3-(2,3-dichlorophenyl)-1-phenyl-1-propan-2-ylurea (PubChem CID 3539470) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-phenyl-1-propan-2-ylurea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-phenyl-1-propan-2-ylurea |
|---|---|
| PubChem CID | 3539470 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-phenyl-1-propan-2-ylurea |
| SMILES | CC(C)N(C(=O)Nc1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-11(2)20(12-7-4-3-5-8-12)16(21)19-14-10-6-9-13(17)15(14)18/h3-11H,1-2H3,(H,19,21) |
| InChIKey | FZXNKUXTHDNZEH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |