C10H12Cl2N2OS — CID 8669095
1-(2,3-dichlorophenyl)-3-(2-methoxyethyl)thiourea (PubChem CID 8669095) has the molecular formula C10H12Cl2N2OS and a molecular weight of 279.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 8669095 |
| Molecular Formula | C10H12Cl2N2OS |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2N2OS/c1-15-6-5-13-10(16)14-8-4-2-3-7(11)9(8)12/h2-4H,5-6H2,1H3,(H2,13,14,16) |
| InChIKey | VJROTCBTBVDRIF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|