C14H20N2O3 — CID 47224610
N-(3-hydroxypropyl)-N'-(2-propylphenyl)oxamide (PubChem CID 47224610) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N'-(2-propylphenyl)oxamide.
| Compound Name | N-(3-hydroxypropyl)-N'-(2-propylphenyl)oxamide |
|---|---|
| PubChem CID | 47224610 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(3-hydroxypropyl)-N'-(2-propylphenyl)oxamide |
| SMILES | CCCc1ccccc1NC(=O)C(=O)NCCCO |
| InChI | InChI=1S/C14H20N2O3/c1-2-6-11-7-3-4-8-12(11)16-14(19)13(18)15-9-5-10-17/h3-4,7-8,17H,2,5-6,9-10H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | DQGGQIYMDBENSW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|