C15H16N2O3 — CID 3102414
N-(3-hydroxypropyl)-N'-naphthalen-1-yloxamide (PubChem CID 3102414) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N'-naphthalen-1-yloxamide.
| Compound Name | N-(3-hydroxypropyl)-N'-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 3102414 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(3-hydroxypropyl)-N'-naphthalen-1-yloxamide |
| SMILES | O=C(NCCCO)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C15H16N2O3/c18-10-4-9-16-14(19)15(20)17-13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8,18H,4,9-10H2,(H,16,19)(H,17,20) |
| InChIKey | QNDMLMJBSGFPPF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|