C18H23N3O2 — CID 108522195
N-[2-(diethylamino)ethyl]-N'-naphthalen-1-yloxamide (PubChem CID 108522195) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-naphthalen-1-yloxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 108522195 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-naphthalen-1-yloxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H23N3O2/c1-3-21(4-2)13-12-19-17(22)18(23)20-16-11-7-9-14-8-5-6-10-15(14)16/h5-11H,3-4,12-13H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | SMMGCBZUNPIETJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|