C13H19ClN4O2 — CID 44902462
N'-(2-chloro-3-pyridinyl)-N-[2-(diethylamino)ethyl]oxamide (PubChem CID 44902462) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is N'-(2-chloro-3-pyridinyl)-N-[2-(diethylamino)ethyl]oxamide.
| Compound Name | N'-(2-chloro-3-pyridinyl)-N-[2-(diethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 44902462 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N'-(2-chloro-3-pyridinyl)-N-[2-(diethylamino)ethyl]oxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C13H19ClN4O2/c1-3-18(4-2)9-8-16-12(19)13(20)17-10-6-5-7-15-11(10)14/h5-7H,3-4,8-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | MSOZMCBIRHSNKI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|