C12H11ClN4O4S — CID 108520506
N'-(2-chloro-3-pyridinyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide (PubChem CID 108520506) has the molecular formula C12H11ClN4O4S and a molecular weight of 342.76 g/mol. Its IUPAC name is N'-(2-chloro-3-pyridinyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide.
| Compound Name | N'-(2-chloro-3-pyridinyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108520506 |
| Molecular Formula | C12H11ClN4O4S |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N'-(2-chloro-3-pyridinyl)-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H11ClN4O4S/c13-9-7(2-1-3-14-9)16-11(20)10(19)15-4-5-17-8(18)6-22-12(17)21/h1-3H,4-6H2,(H,15,19)(H,16,20) |
| InChIKey | RFQXPMUCZRVUAQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|