C18H21N3O6S — CID 108514698
butyl 2-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate (PubChem CID 108514698) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is butyl 2-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108514698 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | butyl 2-[[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C18H21N3O6S/c1-2-3-10-27-17(25)12-6-4-5-7-13(12)20-16(24)15(23)19-8-9-21-14(22)11-28-18(21)26/h4-7H,2-3,8-11H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | NABCXRPJEQKHFV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|