C11H13ClN4O3 — CID 108520470
N'-acetyl-N'-(2-aminoethyl)-N-(2-chloro-3-pyridinyl)oxamide (PubChem CID 108520470) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is N'-acetyl-N'-(2-aminoethyl)-N-(2-chloro-3-pyridinyl)oxamide.
| Compound Name | N'-acetyl-N'-(2-aminoethyl)-N-(2-chloro-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108520470 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N'-acetyl-N'-(2-aminoethyl)-N-(2-chloro-3-pyridinyl)oxamide |
| SMILES | CC(=O)N(CCN)C(=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C11H13ClN4O3/c1-7(17)16(6-4-13)11(19)10(18)15-8-3-2-5-14-9(8)12/h2-3,5H,4,6,13H2,1H3,(H,15,18) |
| InChIKey | UAPHIOZVTSVUNA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|