C15H21N3O3 — CID 108500601
N'-acetyl-N'-(2-aminoethyl)-N-(2-propan-2-ylphenyl)oxamide (PubChem CID 108500601) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N'-acetyl-N'-(2-aminoethyl)-N-(2-propan-2-ylphenyl)oxamide.
| Compound Name | N'-acetyl-N'-(2-aminoethyl)-N-(2-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108500601 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N'-acetyl-N'-(2-aminoethyl)-N-(2-propan-2-ylphenyl)oxamide |
| SMILES | CC(=O)N(CCN)C(=O)C(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C15H21N3O3/c1-10(2)12-6-4-5-7-13(12)17-14(20)15(21)18(9-8-16)11(3)19/h4-7,10H,8-9,16H2,1-3H3,(H,17,20) |
| InChIKey | XXPPMMYUESCULE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|