C16H18N2O4 — CID 108528052
N-(2,2-dimethoxyethyl)-N'-naphthalen-1-yloxamide (PubChem CID 108528052) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-naphthalen-1-yloxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 108528052 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-naphthalen-1-yloxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1cccc2ccccc12)OC |
| InChI | InChI=1S/C16H18N2O4/c1-21-14(22-2)10-17-15(19)16(20)18-13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14H,10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | GPJHSLJVMAIBRK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|