C13H17FN2O4 — CID 146080919
N-(2,2-dimethoxyethyl)-N'-(2-fluoro-5-methylphenyl)oxamide (PubChem CID 146080919) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-(2-fluoro-5-methylphenyl)oxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-(2-fluoro-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 146080919 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-(2-fluoro-5-methylphenyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1cc(C)ccc1F)OC |
| InChI | InChI=1S/C13H17FN2O4/c1-8-4-5-9(14)10(6-8)16-13(18)12(17)15-7-11(19-2)20-3/h4-6,11H,7H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | JYTBXHXPHUWEFA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|