C12H16ClN3O4 — CID 108516166
N'-(4-amino-2-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide (PubChem CID 108516166) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is N'-(4-amino-2-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N'-(4-amino-2-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 108516166 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N'-(4-amino-2-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccc(N)cc1Cl)OC |
| InChI | InChI=1S/C12H16ClN3O4/c1-19-10(20-2)6-15-11(17)12(18)16-9-4-3-7(14)5-8(9)13/h3-5,10H,6,14H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | BLAQADKEEGJREK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|