C13H17N3O5 — CID 108530028
N'-(4-aminobenzoyl)-N-(2,2-dimethoxyethyl)oxamide (PubChem CID 108530028) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is N'-(4-aminobenzoyl)-N-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N'-(4-aminobenzoyl)-N-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 108530028 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N'-(4-aminobenzoyl)-N-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NC(=O)c1ccc(N)cc1)OC |
| InChI | InChI=1S/C13H17N3O5/c1-20-10(21-2)7-15-12(18)13(19)16-11(17)8-3-5-9(14)6-4-8/h3-6,10H,7,14H2,1-2H3,(H,15,18)(H,16,17,19) |
| InChIKey | UROVJMWNYWMHLK-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|