C14H13N3O4 — CID 108517686
N'-(4-aminobenzoyl)-N-(furan-2-ylmethyl)oxamide (PubChem CID 108517686) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is N'-(4-aminobenzoyl)-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-(4-aminobenzoyl)-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108517686 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N'-(4-aminobenzoyl)-N-(furan-2-ylmethyl)oxamide |
| SMILES | Nc1ccc(C(=O)NC(=O)C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C14H13N3O4/c15-10-5-3-9(4-6-10)12(18)17-14(20)13(19)16-8-11-2-1-7-21-11/h1-7H,8,15H2,(H,16,19)(H,17,18,20) |
| InChIKey | SZKVOEDHRFRXPH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|