C15H14N4O3 — CID 108518379
N'-(4-aminobenzoyl)-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 108518379) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N'-(4-aminobenzoyl)-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-(4-aminobenzoyl)-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108518379 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N'-(4-aminobenzoyl)-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | Nc1ccc(C(=O)NC(=O)C(=O)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C15H14N4O3/c16-11-6-4-10(5-7-11)13(20)19-15(22)14(21)18-9-12-3-1-2-8-17-12/h1-8H,9,16H2,(H,18,21)(H,19,20,22) |
| InChIKey | VBRNZNSRLJYAOP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|