C13H17N3O4 — CID 108526364
N'-(4-aminobenzoyl)-N-(1-hydroxybutan-2-yl)oxamide (PubChem CID 108526364) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N'-(4-aminobenzoyl)-N-(1-hydroxybutan-2-yl)oxamide.
| Compound Name | N'-(4-aminobenzoyl)-N-(1-hydroxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526364 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N'-(4-aminobenzoyl)-N-(1-hydroxybutan-2-yl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H17N3O4/c1-2-10(7-17)15-12(19)13(20)16-11(18)8-3-5-9(14)6-4-8/h3-6,10,17H,2,7,14H2,1H3,(H,15,19)(H,16,18,20) |
| InChIKey | JFLXYDHYRKETMK-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|