C12H17N3O4 — CID 65314150
4-amino-N-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethyl]benzamide (PubChem CID 65314150) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-amino-N-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 65314150 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-amino-N-[2-(1,3-dihydroxypropan-2-ylamino)-2-oxoethyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCC(=O)NC(CO)CO)cc1 |
| InChI | InChI=1S/C12H17N3O4/c13-9-3-1-8(2-4-9)12(19)14-5-11(18)15-10(6-16)7-17/h1-4,10,16-17H,5-7,13H2,(H,14,19)(H,15,18) |
| InChIKey | IKIDJHBZCQIQKH-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|