C13H17N3O4 — CID 61161200
2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]butanoic acid (PubChem CID 61161200) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 61161200 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)CNC(=O)c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C13H17N3O4/c1-2-10(13(19)20)16-11(17)7-15-12(18)8-3-5-9(14)6-4-8/h3-6,10H,2,7,14H2,1H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | XKVCIBQRIJSIPI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|