C12H15N3O5 — CID 80751377
(2R)-2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 80751377) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is (2R)-2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80751377 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2R)-2-[[2-[(4-aminobenzoyl)amino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | Nc1ccc(C(=O)NCC(=O)N[C@H](CO)C(=O)O)cc1 |
| InChI | InChI=1S/C12H15N3O5/c13-8-3-1-7(2-4-8)11(18)14-5-10(17)15-9(6-16)12(19)20/h1-4,9,16H,5-6,13H2,(H,14,18)(H,15,17)(H,19,20)/t9-/m1/s1 |
| InChIKey | YXYJNFGDCPAYAD-SECBINFHSA-N |
| XLogP | -1.44 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|