C13H19N3O4 — CID 106188719
4-amino-N-[2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-2-oxoethyl]benzamide (PubChem CID 106188719) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-amino-N-[2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 106188719 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-amino-N-[2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-2-oxoethyl]benzamide |
| SMILES | COCC(CO)NC(=O)CNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H19N3O4/c1-20-8-11(7-17)16-12(18)6-15-13(19)9-2-4-10(14)5-3-9/h2-5,11,17H,6-8,14H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | ARMZFMAQPNRIFS-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|