C10H16N2O2 — CID 106183923
2-(4-aminoanilino)-3-methoxypropan-1-ol (PubChem CID 106183923) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(4-aminoanilino)-3-methoxypropan-1-ol.
| Compound Name | 2-(4-aminoanilino)-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106183923 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-(4-aminoanilino)-3-methoxypropan-1-ol |
| SMILES | COCC(CO)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C10H16N2O2/c1-14-7-10(6-13)12-9-4-2-8(11)3-5-9/h2-5,10,12-13H,6-7,11H2,1H3 |
| InChIKey | SIPWGHNCESIDMP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|