C12H17NO4 — CID 114078956
N-(1-hydroxy-3-methoxypropan-2-yl)-4-methoxybenzamide (PubChem CID 114078956) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(1-hydroxy-3-methoxypropan-2-yl)-4-methoxybenzamide.
| Compound Name | N-(1-hydroxy-3-methoxypropan-2-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 114078956 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(1-hydroxy-3-methoxypropan-2-yl)-4-methoxybenzamide |
| SMILES | COCC(CO)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H17NO4/c1-16-8-10(7-14)13-12(15)9-3-5-11(17-2)6-4-9/h3-6,10,14H,7-8H2,1-2H3,(H,13,15) |
| InChIKey | SZEPMWQYZVNYFK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |