C13H16F3NO4 — CID 103799562
N-(4-hydroxy-1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 103799562) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is N-(4-hydroxy-1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(4-hydroxy-1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 103799562 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(4-hydroxy-1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | COCC(CCO)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO4/c1-20-8-10(6-7-18)17-12(19)9-2-4-11(5-3-9)21-13(14,15)16/h2-5,10,18H,6-8H2,1H3,(H,17,19) |
| InChIKey | QJEIWCJEXMGQLM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |