C12H16INO4 — CID 113434933
3-hydroxy-N-(4-hydroxy-1-methoxybutan-2-yl)-4-iodobenzamide (PubChem CID 113434933) has the molecular formula C12H16INO4 and a molecular weight of 365.17 g/mol. Its IUPAC name is 3-hydroxy-N-(4-hydroxy-1-methoxybutan-2-yl)-4-iodobenzamide.
| Compound Name | 3-hydroxy-N-(4-hydroxy-1-methoxybutan-2-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 113434933 |
| Molecular Formula | C12H16INO4 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 3-hydroxy-N-(4-hydroxy-1-methoxybutan-2-yl)-4-iodobenzamide |
| SMILES | COCC(CCO)NC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C12H16INO4/c1-18-7-9(4-5-15)14-12(17)8-2-3-10(13)11(16)6-8/h2-3,6,9,15-16H,4-5,7H2,1H3,(H,14,17) |
| InChIKey | YZWVZKXDBGLANB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|