C14H20INO3 — CID 104630338
3-hydroxy-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-iodobenzamide (PubChem CID 104630338) has the molecular formula C14H20INO3 and a molecular weight of 377.22 g/mol. Its IUPAC name is 3-hydroxy-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-iodobenzamide.
| Compound Name | 3-hydroxy-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 104630338 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-hydroxy-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-iodobenzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C14H20INO3/c1-14(2,3)12(6-7-17)16-13(19)9-4-5-10(15)11(18)8-9/h4-5,8,12,17-18H,6-7H2,1-3H3,(H,16,19) |
| InChIKey | IZLDHSXGNUBWKJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|