C14H19IN2O3 — CID 104627869
N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-hydroxy-4-iodobenzamide (PubChem CID 104627869) has the molecular formula C14H19IN2O3 and a molecular weight of 390.22 g/mol. Its IUPAC name is N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-hydroxy-4-iodobenzamide.
| Compound Name | N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 104627869 |
| Molecular Formula | C14H19IN2O3 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-hydroxy-4-iodobenzamide |
| SMILES | CC(NC(=O)c1ccc(I)c(O)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H19IN2O3/c1-8(12(19)17-14(2,3)4)16-13(20)9-5-6-10(15)11(18)7-9/h5-8,18H,1-4H3,(H,16,20)(H,17,19) |
| InChIKey | KSQHHCOGLMSYAZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|