C15H23NO4S — CID 103940884
N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-methylsulfonylbenzamide (PubChem CID 103940884) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-methylsulfonylbenzamide.
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 103940884 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-4-methylsulfonylbenzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-15(2,3)13(9-10-17)16-14(18)11-5-7-12(8-6-11)21(4,19)20/h5-8,13,17H,9-10H2,1-4H3,(H,16,18) |
| InChIKey | VDVCCWUZNDUWEH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |