C14H20INO2 — CID 97339820
N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2-iodobenzamide (PubChem CID 97339820) has the molecular formula C14H20INO2 and a molecular weight of 361.22 g/mol. Its IUPAC name is N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2-iodobenzamide.
| Compound Name | N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 97339820 |
| Molecular Formula | C14H20INO2 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2-iodobenzamide |
| SMILES | CC(C)(C)[C@@H](CCO)NC(=O)c1ccccc1I |
| InChI | InChI=1S/C14H20INO2/c1-14(2,3)12(8-9-17)16-13(18)10-6-4-5-7-11(10)15/h4-7,12,17H,8-9H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | YOGKQTZZKPLKJD-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|