C20H28N2O2 — CID 97339825
N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide (PubChem CID 97339825) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide.
| Compound Name | N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 97339825 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H](CCO)C(C)(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H28N2O2/c1-14-13-17(15(2)22(14)16-9-7-6-8-10-16)19(24)21-18(11-12-23)20(3,4)5/h6-10,13,18,23H,11-12H2,1-5H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | DXVUEJPUMNDASK-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|